C37H41N5O3S — CID 166924531
benzyl 2-cyclononylsulfanyl-5-[[6-[4-(dimethylamino)but-2-ynoylamino]quinazolin-4-yl]amino]benzoate (PubChem CID 166924531) has the molecular formula C37H41N5O3S and a molecular weight of 635.83 g/mol. Its IUPAC name is benzyl 2-cyclononylsulfanyl-5-[[6-[4-(dimethylamino)but-2-ynoylamino]quinazolin-4-yl]amino]benzoate.
| Compound Name | benzyl 2-cyclononylsulfanyl-5-[[6-[4-(dimethylamino)but-2-ynoylamino]quinazolin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 166924531 |
| Molecular Formula | C37H41N5O3S |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | benzyl 2-cyclononylsulfanyl-5-[[6-[4-(dimethylamino)but-2-ynoylamino]quinazolin-4-yl]amino]benzoate |
| SMILES | CN(C)CC#CC(=O)Nc1ccc2ncnc(Nc3ccc(SC4CCCCCCCC4)c(C(=O)OCc4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C37H41N5O3S/c1-42(2)22-12-17-35(43)40-28-18-20-33-31(23-28)36(39-26-38-33)41-29-19-21-34(46-30-15-10-5-3-4-6-11-16-30)32(24-29)37(44)45-25-27-13-8-7-9-14-27/h7-9,13-14,18-21,23-24,26,30H,3-6,10-11,15-16,22,25H2,1-2H3,(H,40,43)(H,38,39,41) |
| InChIKey | QVAWKUFHXNAMDY-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|