C24H19ClN4OS — CID 18535907
(E)-N-[4-(3-chloro-4-phenylsulfanylanilino)quinazolin-6-yl]but-2-enamide (PubChem CID 18535907) has the molecular formula C24H19ClN4OS and a molecular weight of 446.96 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-phenylsulfanylanilino)quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-phenylsulfanylanilino)quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 18535907 |
| Molecular Formula | C24H19ClN4OS |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-phenylsulfanylanilino)quinazolin-6-yl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc2ncnc(Nc3ccc(Sc4ccccc4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C24H19ClN4OS/c1-2-6-23(30)28-16-9-11-21-19(13-16)24(27-15-26-21)29-17-10-12-22(20(25)14-17)31-18-7-4-3-5-8-18/h2-15H,1H3,(H,28,30)(H,26,27,29)/b6-2+ |
| InChIKey | HRDOGFDBPDRCBR-QHHAFSJGSA-N |
| XLogP | 6.69 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|