C30H30N6O3 — CID 18535806
7-morpholin-4-yl-N-[4-(4-phenoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide (PubChem CID 18535806) has the molecular formula C30H30N6O3 and a molecular weight of 522.61 g/mol. Its IUPAC name is 7-morpholin-4-yl-N-[4-(4-phenoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide.
| Compound Name | 7-morpholin-4-yl-N-[4-(4-phenoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide |
|---|---|
| PubChem CID | 18535806 |
| Molecular Formula | C30H30N6O3 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 7-morpholin-4-yl-N-[4-(4-phenoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide |
| SMILES | O=C(C#CCCCCN1CCOCC1)Nc1cc2c(Nc3ccc(Oc4ccccc4)cc3)ncnc2cn1 |
| InChI | InChI=1S/C30H30N6O3/c37-29(10-6-1-2-7-15-36-16-18-38-19-17-36)35-28-20-26-27(21-31-28)32-22-33-30(26)34-23-11-13-25(14-12-23)39-24-8-4-3-5-9-24/h3-5,8-9,11-14,20-22H,1-2,7,15-19H2,(H,31,35,37)(H,32,33,34) |
| InChIKey | VCBAXJNCENZYBE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|