C25H25N7O — CID 18176192
7-imidazol-1-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide (PubChem CID 18176192) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is 7-imidazol-1-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide.
| Compound Name | 7-imidazol-1-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide |
|---|---|
| PubChem CID | 18176192 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 7-imidazol-1-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-ynamide |
| SMILES | CC(Nc1ncnc2cnc(NC(=O)C#CCCCCn3ccnc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C25H25N7O/c1-19(20-9-5-4-6-10-20)30-25-21-15-23(27-16-22(21)28-17-29-25)31-24(33)11-7-2-3-8-13-32-14-12-26-18-32/h4-6,9-10,12,14-19H,2-3,8,13H2,1H3,(H,27,31,33)(H,28,29,30) |
| InChIKey | NICPVJVJOSMJCC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|