C26H30F2N6O2 — CID 18176190
(E)-4,4-difluoro-7-morpholin-4-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-enamide (PubChem CID 18176190) has the molecular formula C26H30F2N6O2 and a molecular weight of 496.56 g/mol. Its IUPAC name is (E)-4,4-difluoro-7-morpholin-4-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-enamide.
| Compound Name | (E)-4,4-difluoro-7-morpholin-4-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-enamide |
|---|---|
| PubChem CID | 18176190 |
| Molecular Formula | C26H30F2N6O2 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (E)-4,4-difluoro-7-morpholin-4-yl-N-[4-(1-phenylethylamino)pyrido[3,4-d]pyrimidin-6-yl]hept-2-enamide |
| SMILES | CC(Nc1ncnc2cnc(NC(=O)/C=C/C(F)(F)CCCN3CCOCC3)cc12)c1ccccc1 |
| InChI | InChI=1S/C26H30F2N6O2/c1-19(20-6-3-2-4-7-20)32-25-21-16-23(29-17-22(21)30-18-31-25)33-24(35)8-10-26(27,28)9-5-11-34-12-14-36-15-13-34/h2-4,6-8,10,16-19H,5,9,11-15H2,1H3,(H,29,33,35)(H,30,31,32)/b10-8+ |
| InChIKey | SPRONQIWRFGJIR-CSKARUKUSA-N |
| XLogP | 4.44 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|