C30H36N6O3 — CID 25176772
4-(2-hydroxyethyl)-N-(3-morpholin-4-ylpropyl)-1-[4-(1-phenylethylamino)quinazolin-6-yl]pyrrole-3-carboxamide (PubChem CID 25176772) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-N-(3-morpholin-4-ylpropyl)-1-[4-(1-phenylethylamino)quinazolin-6-yl]pyrrole-3-carboxamide.
| Compound Name | 4-(2-hydroxyethyl)-N-(3-morpholin-4-ylpropyl)-1-[4-(1-phenylethylamino)quinazolin-6-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 25176772 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 4-(2-hydroxyethyl)-N-(3-morpholin-4-ylpropyl)-1-[4-(1-phenylethylamino)quinazolin-6-yl]pyrrole-3-carboxamide |
| SMILES | CC(Nc1ncnc2ccc(-n3cc(CCO)c(C(=O)NCCCN4CCOCC4)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C30H36N6O3/c1-22(23-6-3-2-4-7-23)34-29-26-18-25(8-9-28(26)32-21-33-29)36-19-24(10-15-37)27(20-36)30(38)31-11-5-12-35-13-16-39-17-14-35/h2-4,6-9,18-22,37H,5,10-17H2,1H3,(H,31,38)(H,32,33,34) |
| InChIKey | ZOSQZFVNVVOTMY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|