C27H31N7O2 — CID 10368118
N-(3-morpholin-4-ylpropyl)-1-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide (PubChem CID 10368118) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-1-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-1-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10368118 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-1-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide |
| SMILES | C[C@H](Nc1cncc(-n2cnc3cc(C(=O)NCCCN4CCOCC4)ccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C27H31N7O2/c1-20(21-6-3-2-4-7-21)31-25-17-28-18-26(32-25)34-19-30-23-16-22(8-9-24(23)34)27(35)29-10-5-11-33-12-14-36-15-13-33/h2-4,6-9,16-20H,5,10-15H2,1H3,(H,29,35)(H,31,32)/t20-/m0/s1 |
| InChIKey | QVIFPDJBZARZKN-FQEVSTJZSA-N |
| XLogP | 3.44 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|