C27H24N6O — CID 59924918
N-benzyl-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazole-5-carboxamide (PubChem CID 59924918) has the molecular formula C27H24N6O and a molecular weight of 448.53 g/mol. Its IUPAC name is N-benzyl-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazole-5-carboxamide.
| Compound Name | N-benzyl-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59924918 |
| Molecular Formula | C27H24N6O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-benzyl-3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazole-5-carboxamide |
| SMILES | C[C@H](Nc1nccc(-n2cnc3ccc(C(=O)NCc4ccccc4)cc32)n1)c1ccccc1 |
| InChI | InChI=1S/C27H24N6O/c1-19(21-10-6-3-7-11-21)31-27-28-15-14-25(32-27)33-18-30-23-13-12-22(16-24(23)33)26(34)29-17-20-8-4-2-5-9-20/h2-16,18-19H,17H2,1H3,(H,29,34)(H,28,31,32)/t19-/m0/s1 |
| InChIKey | WHIKBMWPXSMNND-IBGZPJMESA-N |
| XLogP | 4.92 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |