C21H23N6O3P — CID 59924948
N-dimethoxyphosphoryl-1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-amine (PubChem CID 59924948) has the molecular formula C21H23N6O3P and a molecular weight of 438.43 g/mol. Its IUPAC name is N-dimethoxyphosphoryl-1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-amine.
| Compound Name | N-dimethoxyphosphoryl-1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 59924948 |
| Molecular Formula | C21H23N6O3P |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-dimethoxyphosphoryl-1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-amine |
| SMILES | COP(=O)(Nc1ccc2c(c1)ncn2-c1ccnc(N[C@@H](C)c2ccccc2)n1)OC |
| InChI | InChI=1S/C21H23N6O3P/c1-15(16-7-5-4-6-8-16)24-21-22-12-11-20(25-21)27-14-23-18-13-17(9-10-19(18)27)26-31(28,29-2)30-3/h4-15H,1-3H3,(H,26,28)(H,22,24,25)/t15-/m0/s1 |
| InChIKey | VBQVZJLFYVEZRZ-HNNXBMFYSA-N |
| XLogP | 4.80 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|