C28H23N7O — CID 18375836
N-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]-1H-indole-2-carboxamide (PubChem CID 18375836) has the molecular formula C28H23N7O and a molecular weight of 473.54 g/mol. Its IUPAC name is N-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 18375836 |
| Molecular Formula | C28H23N7O |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]-1H-indole-2-carboxamide |
| SMILES | CC(Nc1nccc(-n2cnc3cc(NC(=O)c4cc5ccccc5[nH]4)ccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C28H23N7O/c1-18(19-7-3-2-4-8-19)31-28-29-14-13-26(34-28)35-17-30-23-16-21(11-12-25(23)35)32-27(36)24-15-20-9-5-6-10-22(20)33-24/h2-18,33H,1H3,(H,32,36)(H,29,31,34) |
| InChIKey | NXZZXMVWCLAISK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |