C26H28N6O — CID 18342799
N-[1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-yl]cyclohexanecarboxamide (PubChem CID 18342799) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18342799 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-[1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzimidazol-5-yl]cyclohexanecarboxamide |
| SMILES | C[C@H](Nc1nccc(-n2cnc3cc(NC(=O)C4CCCCC4)ccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C26H28N6O/c1-18(19-8-4-2-5-9-19)29-26-27-15-14-24(31-26)32-17-28-22-16-21(12-13-23(22)32)30-25(33)20-10-6-3-7-11-20/h2,4-5,8-9,12-18,20H,3,6-7,10-11H2,1H3,(H,30,33)(H,27,29,31)/t18-/m0/s1 |
| InChIKey | RDYRCWHLNCNVIY-SFHVURJKSA-N |
| XLogP | 5.51 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |