C23H22N6O — CID 85141042
N-[1-[6-(1-phenylethylamino)pyrazin-2-yl]benzimidazol-5-yl]cyclopropanecarboxamide (PubChem CID 85141042) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[1-[6-(1-phenylethylamino)pyrazin-2-yl]benzimidazol-5-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[6-(1-phenylethylamino)pyrazin-2-yl]benzimidazol-5-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 85141042 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[1-[6-(1-phenylethylamino)pyrazin-2-yl]benzimidazol-5-yl]cyclopropanecarboxamide |
| SMILES | CC(Nc1cncc(-n2cnc3cc(NC(=O)C4CC4)ccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C23H22N6O/c1-15(16-5-3-2-4-6-16)26-21-12-24-13-22(28-21)29-14-25-19-11-18(9-10-20(19)29)27-23(30)17-7-8-17/h2-6,9-15,17H,7-8H2,1H3,(H,26,28)(H,27,30) |
| InChIKey | BNLISOMNIBYKOT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |