C18H16N6 — CID 10358390
6-imidazo[4,5-c]pyridin-3-yl-N-[(1S)-1-phenylethyl]pyrazin-2-amine (PubChem CID 10358390) has the molecular formula C18H16N6 and a molecular weight of 316.37 g/mol. Its IUPAC name is 6-imidazo[4,5-c]pyridin-3-yl-N-[(1S)-1-phenylethyl]pyrazin-2-amine.
| Compound Name | 6-imidazo[4,5-c]pyridin-3-yl-N-[(1S)-1-phenylethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 10358390 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 6-imidazo[4,5-c]pyridin-3-yl-N-[(1S)-1-phenylethyl]pyrazin-2-amine |
| SMILES | C[C@H](Nc1cncc(-n2cnc3ccncc32)n1)c1ccccc1 |
| InChI | InChI=1S/C18H16N6/c1-13(14-5-3-2-4-6-14)22-17-10-20-11-18(23-17)24-12-21-15-7-8-19-9-16(15)24/h2-13H,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | TXVXSTSDJXAYHO-ZDUSSCGKSA-N |
| XLogP | 3.38 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |