C26H26N8O — CID 10479664
N-(3-imidazol-1-ylpropyl)-3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide (PubChem CID 10479664) has the molecular formula C26H26N8O and a molecular weight of 466.55 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10479664 |
| Molecular Formula | C26H26N8O |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazole-5-carboxamide |
| SMILES | C[C@H](Nc1cncc(-n2cnc3ccc(C(=O)NCCCn4ccnc4)cc32)n1)c1ccccc1 |
| InChI | InChI=1S/C26H26N8O/c1-19(20-6-3-2-4-7-20)31-24-15-28-16-25(32-24)34-18-30-22-9-8-21(14-23(22)34)26(35)29-10-5-12-33-13-11-27-17-33/h2-4,6-9,11,13-19H,5,10,12H2,1H3,(H,29,35)(H,31,32)/t19-/m0/s1 |
| InChIKey | LXRQJCTZKHYZAC-IBGZPJMESA-N |
| XLogP | 4.01 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|