C24H20N8O — CID 10026029
N-[3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazol-5-yl]pyrazine-2-carboxamide (PubChem CID 10026029) has the molecular formula C24H20N8O and a molecular weight of 436.48 g/mol. Its IUPAC name is N-[3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazol-5-yl]pyrazine-2-carboxamide.
| Compound Name | N-[3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazol-5-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10026029 |
| Molecular Formula | C24H20N8O |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[3-[6-[[(1S)-1-phenylethyl]amino]pyrazin-2-yl]benzimidazol-5-yl]pyrazine-2-carboxamide |
| SMILES | C[C@H](Nc1cncc(-n2cnc3ccc(NC(=O)c4cnccn4)cc32)n1)c1ccccc1 |
| InChI | InChI=1S/C24H20N8O/c1-16(17-5-3-2-4-6-17)29-22-13-26-14-23(31-22)32-15-28-19-8-7-18(11-21(19)32)30-24(33)20-12-25-9-10-27-20/h2-16H,1H3,(H,29,31)(H,30,33)/t16-/m0/s1 |
| InChIKey | CCSJIKMKDRJYEL-INIZCTEOSA-N |
| XLogP | 4.03 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |