C20H21N9 — CID 142035815
N,N'-diamino-3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazole-5-carboximidamide (PubChem CID 142035815) has the molecular formula C20H21N9 and a molecular weight of 387.45 g/mol. Its IUPAC name is N,N'-diamino-3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazole-5-carboximidamide.
| Compound Name | N,N'-diamino-3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 142035815 |
| Molecular Formula | C20H21N9 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N,N'-diamino-3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazole-5-carboximidamide |
| SMILES | CC(Nc1nccc(-n2cnc3ccc(/C(=N/N)NN)cc32)n1)c1ccccc1 |
| InChI | InChI=1S/C20H21N9/c1-13(14-5-3-2-4-6-14)25-20-23-10-9-18(26-20)29-12-24-16-8-7-15(11-17(16)29)19(27-21)28-22/h2-13H,21-22H2,1H3,(H,27,28)(H,23,25,26) |
| InChIKey | DBFKNEPWURHAQH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|