C26H20N6 — CID 18375990
4-[3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzonitrile (PubChem CID 18375990) has the molecular formula C26H20N6 and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-[3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzonitrile.
| Compound Name | 4-[3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 18375990 |
| Molecular Formula | C26H20N6 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-[3-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzonitrile |
| SMILES | CC(Nc1nccc(-n2cnc3ccc(-c4ccc(C#N)cc4)cc32)n1)c1ccccc1 |
| InChI | InChI=1S/C26H20N6/c1-18(20-5-3-2-4-6-20)30-26-28-14-13-25(31-26)32-17-29-23-12-11-22(15-24(23)32)21-9-7-19(16-27)8-10-21/h2-15,17-18H,1H3,(H,28,30,31) |
| InChIKey | KIDXFINENWPFOW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |