C25H23N7 — CID 18375623
4-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzene-1,2-diamine (PubChem CID 18375623) has the molecular formula C25H23N7 and a molecular weight of 421.51 g/mol. Its IUPAC name is 4-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzene-1,2-diamine.
| Compound Name | 4-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 18375623 |
| Molecular Formula | C25H23N7 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-[1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-5-yl]benzene-1,2-diamine |
| SMILES | CC(Nc1nccc(-n2cnc3cc(-c4ccc(N)c(N)c4)ccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C25H23N7/c1-16(17-5-3-2-4-6-17)30-25-28-12-11-24(31-25)32-15-29-22-14-19(8-10-23(22)32)18-7-9-20(26)21(27)13-18/h2-16H,26-27H2,1H3,(H,28,30,31) |
| InChIKey | JZUXYNQYKHVIGN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|