C25H20N6O2 — CID 18375704
4-[5-(3-nitrophenyl)benzimidazol-1-yl]-N-(1-phenylethyl)pyrimidin-2-amine (PubChem CID 18375704) has the molecular formula C25H20N6O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 4-[5-(3-nitrophenyl)benzimidazol-1-yl]-N-(1-phenylethyl)pyrimidin-2-amine.
| Compound Name | 4-[5-(3-nitrophenyl)benzimidazol-1-yl]-N-(1-phenylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 18375704 |
| Molecular Formula | C25H20N6O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-[5-(3-nitrophenyl)benzimidazol-1-yl]-N-(1-phenylethyl)pyrimidin-2-amine |
| SMILES | CC(Nc1nccc(-n2cnc3cc(-c4cccc([N+](=O)[O-])c4)ccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C25H20N6O2/c1-17(18-6-3-2-4-7-18)28-25-26-13-12-24(29-25)30-16-27-22-15-20(10-11-23(22)30)19-8-5-9-21(14-19)31(32)33/h2-17H,1H3,(H,26,28,29) |
| InChIKey | PFEPNPYWSVTLLX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|