C27H25N5O3 — CID 162431826
5-hydroxy-N-methyl-N-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]pent-2-ynamide (PubChem CID 162431826) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 5-hydroxy-N-methyl-N-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]pent-2-ynamide.
| Compound Name | 5-hydroxy-N-methyl-N-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]pent-2-ynamide |
|---|---|
| PubChem CID | 162431826 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 5-hydroxy-N-methyl-N-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]pent-2-ynamide |
| SMILES | Cc1ccc(Oc2ccc(Nc3ncnc4ccc(N(C)C(=O)C#CCCO)cc34)cc2C)cn1 |
| InChI | InChI=1S/C27H25N5O3/c1-18-14-20(8-12-25(18)35-22-10-7-19(2)28-16-22)31-27-23-15-21(9-11-24(23)29-17-30-27)32(3)26(34)6-4-5-13-33/h7-12,14-17,33H,5,13H2,1-3H3,(H,29,30,31) |
| InChIKey | FBPASONTRRNTTO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|