C28H27N5O3S — CID 22484329
2-(2-hydroxyethylsulfanyl)-N-[3-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]prop-2-ynyl]acetamide (PubChem CID 22484329) has the molecular formula C28H27N5O3S and a molecular weight of 513.62 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfanyl)-N-[3-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]prop-2-ynyl]acetamide.
| Compound Name | 2-(2-hydroxyethylsulfanyl)-N-[3-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 22484329 |
| Molecular Formula | C28H27N5O3S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 2-(2-hydroxyethylsulfanyl)-N-[3-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]prop-2-ynyl]acetamide |
| SMILES | Cc1ccc(Oc2ccc(Nc3ncnc4ccc(C#CCNC(=O)CSCCO)cc34)cc2C)cn1 |
| InChI | InChI=1S/C28H27N5O3S/c1-19-14-22(7-10-26(19)36-23-8-5-20(2)30-16-23)33-28-24-15-21(6-9-25(24)31-18-32-28)4-3-11-29-27(35)17-37-13-12-34/h5-10,14-16,18,34H,11-13,17H2,1-2H3,(H,29,35)(H,31,32,33) |
| InChIKey | IDIBIOLJVVIFDV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|