C26H24N4O3 — CID 22484384
6-[3-(2-methoxyethoxy)prop-1-ynyl]-N-(3-methyl-4-pyridin-3-yloxyphenyl)quinazolin-4-amine (PubChem CID 22484384) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 6-[3-(2-methoxyethoxy)prop-1-ynyl]-N-(3-methyl-4-pyridin-3-yloxyphenyl)quinazolin-4-amine.
| Compound Name | 6-[3-(2-methoxyethoxy)prop-1-ynyl]-N-(3-methyl-4-pyridin-3-yloxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 22484384 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 6-[3-(2-methoxyethoxy)prop-1-ynyl]-N-(3-methyl-4-pyridin-3-yloxyphenyl)quinazolin-4-amine |
| SMILES | COCCOCC#Cc1ccc2ncnc(Nc3ccc(Oc4cccnc4)c(C)c3)c2c1 |
| InChI | InChI=1S/C26H24N4O3/c1-19-15-21(8-10-25(19)33-22-6-3-11-27-17-22)30-26-23-16-20(5-4-12-32-14-13-31-2)7-9-24(23)28-18-29-26/h3,6-11,15-18H,12-14H2,1-2H3,(H,28,29,30) |
| InChIKey | STLZWGYSFYBWPU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|