C30H29N5O3 — CID 174382691
methyl 4-[3-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]prop-2-ynyl]piperazine-1-carboxylate (PubChem CID 174382691) has the molecular formula C30H29N5O3 and a molecular weight of 507.59 g/mol. Its IUPAC name is methyl 4-[3-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]prop-2-ynyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[3-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]prop-2-ynyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174382691 |
| Molecular Formula | C30H29N5O3 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | methyl 4-[3-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]prop-2-ynyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(CC#Cc2ccc3ncnc(Nc4ccc(Oc5ccccc5)c(C)c4)c3c2)CC1 |
| InChI | InChI=1S/C30H29N5O3/c1-22-19-24(11-13-28(22)38-25-8-4-3-5-9-25)33-29-26-20-23(10-12-27(26)31-21-32-29)7-6-14-34-15-17-35(18-16-34)30(36)37-2/h3-5,8-13,19-21H,14-18H2,1-2H3,(H,31,32,33) |
| InChIKey | VRAHXMIYKYJUGO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|