C28H26N4O — CID 22985695
N-(3-methyl-4-phenoxyphenyl)-6-[2-[(3S)-piperidin-3-yl]ethynyl]quinazolin-4-amine (PubChem CID 22985695) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(3-methyl-4-phenoxyphenyl)-6-[2-[(3S)-piperidin-3-yl]ethynyl]quinazolin-4-amine.
| Compound Name | N-(3-methyl-4-phenoxyphenyl)-6-[2-[(3S)-piperidin-3-yl]ethynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 22985695 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-(3-methyl-4-phenoxyphenyl)-6-[2-[(3S)-piperidin-3-yl]ethynyl]quinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3ccc(C#C[C@@H]4CCCNC4)cc23)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C28H26N4O/c1-20-16-23(12-14-27(20)33-24-7-3-2-4-8-24)32-28-25-17-21(11-13-26(25)30-19-31-28)9-10-22-6-5-15-29-18-22/h2-4,7-8,11-14,16-17,19,22,29H,5-6,15,18H2,1H3,(H,30,31,32)/t22-/m0/s1 |
| InChIKey | IGMLBYRCRPUJBY-QFIPXVFZSA-N |
| XLogP | 5.83 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|