C27H24ClN5O — CID 22484149
N-[3-chloro-4-[(6-methyl-3-pyridinyl)oxy]phenyl]-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine (PubChem CID 22484149) has the molecular formula C27H24ClN5O and a molecular weight of 469.98 g/mol. Its IUPAC name is N-[3-chloro-4-[(6-methyl-3-pyridinyl)oxy]phenyl]-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(6-methyl-3-pyridinyl)oxy]phenyl]-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 22484149 |
| Molecular Formula | C27H24ClN5O |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[3-chloro-4-[(6-methyl-3-pyridinyl)oxy]phenyl]-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine |
| SMILES | Cc1ccc(Oc2ccc(Nc3ncnc4ccc(C#CC5CCCNC5)cc34)cc2Cl)cn1 |
| InChI | InChI=1S/C27H24ClN5O/c1-18-4-9-22(16-30-18)34-26-11-8-21(14-24(26)28)33-27-23-13-19(7-10-25(23)31-17-32-27)5-6-20-3-2-12-29-15-20/h4,7-11,13-14,16-17,20,29H,2-3,12,15H2,1H3,(H,31,32,33) |
| InChIKey | XOCKQBWZNJVROG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|