C29H28N4O3 — CID 70034685
7-methoxy-N-(3-methoxy-4-phenoxyphenyl)-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine (PubChem CID 70034685) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 7-methoxy-N-(3-methoxy-4-phenoxyphenyl)-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine.
| Compound Name | 7-methoxy-N-(3-methoxy-4-phenoxyphenyl)-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 70034685 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 7-methoxy-N-(3-methoxy-4-phenoxyphenyl)-6-(2-piperidin-3-ylethynyl)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Oc4ccccc4)c(OC)c3)c2cc1C#CC1CCCNC1 |
| InChI | InChI=1S/C29H28N4O3/c1-34-27-17-25-24(15-21(27)11-10-20-7-6-14-30-18-20)29(32-19-31-25)33-22-12-13-26(28(16-22)35-2)36-23-8-4-3-5-9-23/h3-5,8-9,12-13,15-17,19-20,30H,6-7,14,18H2,1-2H3,(H,31,32,33) |
| InChIKey | DMINCDPBPFWDRS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|