C24H21N3O5 — CID 69053494
4-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenoxy]benzoic acid (PubChem CID 69053494) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 4-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenoxy]benzoic acid.
| Compound Name | 4-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 69053494 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenoxy]benzoic acid |
| SMILES | COc1cc2ncnc(Nc3ccc(Oc4ccc(C(=O)O)cc4)c(C)c3)c2cc1OC |
| InChI | InChI=1S/C24H21N3O5/c1-14-10-16(6-9-20(14)32-17-7-4-15(5-8-17)24(28)29)27-23-18-11-21(30-2)22(31-3)12-19(18)25-13-26-23/h4-13H,1-3H3,(H,28,29)(H,25,26,27) |
| InChIKey | FVARGMXCQDUOGL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |