C29H33N5O4 — CID 69054481
N-(2,2-dimethylpropyl)-4-[4-[[6-(2-methoxyethoxy)pyrido[3,4-d]pyrimidin-4-yl]amino]-2-methylphenoxy]benzamide (PubChem CID 69054481) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-4-[4-[[6-(2-methoxyethoxy)pyrido[3,4-d]pyrimidin-4-yl]amino]-2-methylphenoxy]benzamide.
| Compound Name | N-(2,2-dimethylpropyl)-4-[4-[[6-(2-methoxyethoxy)pyrido[3,4-d]pyrimidin-4-yl]amino]-2-methylphenoxy]benzamide |
|---|---|
| PubChem CID | 69054481 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | N-(2,2-dimethylpropyl)-4-[4-[[6-(2-methoxyethoxy)pyrido[3,4-d]pyrimidin-4-yl]amino]-2-methylphenoxy]benzamide |
| SMILES | COCCOc1cc2c(Nc3ccc(Oc4ccc(C(=O)NCC(C)(C)C)cc4)c(C)c3)ncnc2cn1 |
| InChI | InChI=1S/C29H33N5O4/c1-19-14-21(34-27-23-15-26(37-13-12-36-5)30-16-24(23)32-18-33-27)8-11-25(19)38-22-9-6-20(7-10-22)28(35)31-17-29(2,3)4/h6-11,14-16,18H,12-13,17H2,1-5H3,(H,31,35)(H,32,33,34) |
| InChIKey | HNIPAHJKLRQSJM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|