C30H35N5O6 — CID 11577688
3,5-dihydroxy-N-(2-methoxyethyl)-6-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]oxyhexanamide (PubChem CID 11577688) has the molecular formula C30H35N5O6 and a molecular weight of 561.64 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(2-methoxyethyl)-6-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]oxyhexanamide.
| Compound Name | 3,5-dihydroxy-N-(2-methoxyethyl)-6-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]oxyhexanamide |
|---|---|
| PubChem CID | 11577688 |
| Molecular Formula | C30H35N5O6 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | 3,5-dihydroxy-N-(2-methoxyethyl)-6-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-6-yl]oxyhexanamide |
| SMILES | COCCNC(=O)CC(O)CC(O)COc1ccc2ncnc(Nc3ccc(Oc4ccc(C)nc4)c(C)c3)c2c1 |
| InChI | InChI=1S/C30H35N5O6/c1-19-12-21(5-9-28(19)41-25-6-4-20(2)32-16-25)35-30-26-15-24(7-8-27(26)33-18-34-30)40-17-23(37)13-22(36)14-29(38)31-10-11-39-3/h4-9,12,15-16,18,22-23,36-37H,10-11,13-14,17H2,1-3H3,(H,31,38)(H,33,34,35) |
| InChIKey | VVPTVYBIWVPWDW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|