C25H23ClN4O3S — CID 66937017
N-[4-(1,3-benzothiazol-5-yloxy)-3-methylphenyl]-6-(2-methoxyethoxy)quinazolin-4-amine;hydrochloride (PubChem CID 66937017) has the molecular formula C25H23ClN4O3S and a molecular weight of 495.00 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-5-yloxy)-3-methylphenyl]-6-(2-methoxyethoxy)quinazolin-4-amine;hydrochloride.
| Compound Name | N-[4-(1,3-benzothiazol-5-yloxy)-3-methylphenyl]-6-(2-methoxyethoxy)quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 66937017 |
| Molecular Formula | C25H23ClN4O3S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[4-(1,3-benzothiazol-5-yloxy)-3-methylphenyl]-6-(2-methoxyethoxy)quinazolin-4-amine;hydrochloride |
| SMILES | COCCOc1ccc2ncnc(Nc3ccc(Oc4ccc5scnc5c4)c(C)c3)c2c1.Cl |
| InChI | InChI=1S/C25H22N4O3S.ClH/c1-16-11-17(3-7-23(16)32-19-5-8-24-22(13-19)28-15-33-24)29-25-20-12-18(31-10-9-30-2)4-6-21(20)26-14-27-25;/h3-8,11-15H,9-10H2,1-2H3,(H,26,27,29);1H |
| InChIKey | XYYJJCAFSBPYPI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|