C24H20ClN5O3 — CID 58139975
N-(3-chloro-4-imidazo[1,2-a]pyridin-7-yloxyphenyl)-6-(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 58139975) has the molecular formula C24H20ClN5O3 and a molecular weight of 461.91 g/mol. Its IUPAC name is N-(3-chloro-4-imidazo[1,2-a]pyridin-7-yloxyphenyl)-6-(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-imidazo[1,2-a]pyridin-7-yloxyphenyl)-6-(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 58139975 |
| Molecular Formula | C24H20ClN5O3 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-(3-chloro-4-imidazo[1,2-a]pyridin-7-yloxyphenyl)-6-(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | COCCOc1ccc2ncnc(Nc3ccc(Oc4ccn5ccnc5c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C24H20ClN5O3/c1-31-10-11-32-17-3-4-21-19(13-17)24(28-15-27-21)29-16-2-5-22(20(25)12-16)33-18-6-8-30-9-7-26-23(30)14-18/h2-9,12-15H,10-11H2,1H3,(H,27,28,29) |
| InChIKey | DBBFTFJVHNYHEZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|