C22H18ClN7O3 — CID 162431802
N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine;ethane (PubChem CID 162431802) has the molecular formula C22H18ClN7O3 and a molecular weight of 463.89 g/mol. Its IUPAC name is N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine;ethane.
| Compound Name | N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 162431802 |
| Molecular Formula | C22H18ClN7O3 |
| Molecular Weight | 463.89 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine;ethane |
| SMILES | CC.O=[N+]([O-])c1ccc2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C20H12ClN7O3.C2H6/c21-16-7-12(1-4-18(16)31-14-5-6-27-19(9-14)23-11-25-27)26-20-15-8-13(28(29)30)2-3-17(15)22-10-24-20;1-2/h1-11H,(H,22,24,26);1-2H3 |
| InChIKey | CUHVWRPWZXJRGB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.89 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|