C24H21ClN8O4 — CID 162431884
N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-7-[2-(dimethylamino)ethoxy]-6-nitroquinazolin-4-amine (PubChem CID 162431884) has the molecular formula C24H21ClN8O4 and a molecular weight of 520.94 g/mol. Its IUPAC name is N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-7-[2-(dimethylamino)ethoxy]-6-nitroquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-7-[2-(dimethylamino)ethoxy]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 162431884 |
| Molecular Formula | C24H21ClN8O4 |
| Molecular Weight | 520.94 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | N-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-7-[2-(dimethylamino)ethoxy]-6-nitroquinazolin-4-amine |
| SMILES | CN(C)CCOc1cc2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(Cl)c3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21ClN8O4/c1-31(2)7-8-36-22-12-19-17(11-20(22)33(34)35)24(28-13-26-19)30-15-3-4-21(18(25)9-15)37-16-5-6-32-23(10-16)27-14-29-32/h3-6,9-14H,7-8H2,1-2H3,(H,26,28,30) |
| InChIKey | JYYZAWQZVCUPRO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|