C25H23FN8O4 — CID 162431857
7-[2-(dimethylamino)ethoxy]-N-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine (PubChem CID 162431857) has the molecular formula C25H23FN8O4 and a molecular weight of 518.51 g/mol. Its IUPAC name is 7-[2-(dimethylamino)ethoxy]-N-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine.
| Compound Name | 7-[2-(dimethylamino)ethoxy]-N-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 162431857 |
| Molecular Formula | C25H23FN8O4 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 7-[2-(dimethylamino)ethoxy]-N-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-6-nitroquinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3cc(OCCN(C)C)c([N+](=O)[O-])cc23)c(F)cc1Oc1ccn2ncnc2c1 |
| InChI | InChI=1S/C25H23FN8O4/c1-15-8-20(18(26)11-22(15)38-16-4-5-33-24(9-16)28-14-30-33)31-25-17-10-21(34(35)36)23(37-7-6-32(2)3)12-19(17)27-13-29-25/h4-5,8-14H,6-7H2,1-3H3,(H,27,29,31) |
| InChIKey | XARVIBICTCFEAW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|