C17H12Cl2FN5O5 — CID 69100660
2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid (PubChem CID 69100660) has the molecular formula C17H12Cl2FN5O5 and a molecular weight of 456.22 g/mol. Its IUPAC name is 2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid.
| Compound Name | 2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid |
|---|---|
| PubChem CID | 69100660 |
| Molecular Formula | C17H12Cl2FN5O5 |
| Molecular Weight | 456.22 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid |
| SMILES | O=C(O)NCCOc1cc2ncnc(Nc3cc(Cl)c(Cl)cc3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12Cl2FN5O5/c18-9-4-11(20)13(5-10(9)19)24-16-8-3-14(25(28)29)15(6-12(8)22-7-23-16)30-2-1-21-17(26)27/h3-7,21H,1-2H2,(H,26,27)(H,22,23,24) |
| InChIKey | VZUGEATVDKZDQG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|