C20H17Cl3F2N4O3 — CID 24960475
2-chloro-N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-(2-fluoroethoxy)ethoxy]quinazolin-6-yl]acetamide (PubChem CID 24960475) has the molecular formula C20H17Cl3F2N4O3 and a molecular weight of 505.74 g/mol. Its IUPAC name is 2-chloro-N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-(2-fluoroethoxy)ethoxy]quinazolin-6-yl]acetamide.
| Compound Name | 2-chloro-N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-(2-fluoroethoxy)ethoxy]quinazolin-6-yl]acetamide |
|---|---|
| PubChem CID | 24960475 |
| Molecular Formula | C20H17Cl3F2N4O3 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 2-chloro-N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-(2-fluoroethoxy)ethoxy]quinazolin-6-yl]acetamide |
| SMILES | O=C(CCl)Nc1cc2c(Nc3cc(Cl)c(Cl)cc3F)ncnc2cc1OCCOCCF |
| InChI | InChI=1S/C20H17Cl3F2N4O3/c21-9-19(30)28-17-5-11-15(8-18(17)32-4-3-31-2-1-24)26-10-27-20(11)29-16-7-13(23)12(22)6-14(16)25/h5-8,10H,1-4,9H2,(H,28,30)(H,26,27,29) |
| InChIKey | NIBZYSBXZIUMFJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|