C18H17Cl2FN4O2 — CID 69320196
4-N-(4,5-dichloro-2-fluorophenyl)-7-(2-ethoxyethoxy)quinazoline-4,6-diamine (PubChem CID 69320196) has the molecular formula C18H17Cl2FN4O2 and a molecular weight of 411.26 g/mol. Its IUPAC name is 4-N-(4,5-dichloro-2-fluorophenyl)-7-(2-ethoxyethoxy)quinazoline-4,6-diamine.
| Compound Name | 4-N-(4,5-dichloro-2-fluorophenyl)-7-(2-ethoxyethoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 69320196 |
| Molecular Formula | C18H17Cl2FN4O2 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 4-N-(4,5-dichloro-2-fluorophenyl)-7-(2-ethoxyethoxy)quinazoline-4,6-diamine |
| SMILES | CCOCCOc1cc2ncnc(Nc3cc(Cl)c(Cl)cc3F)c2cc1N |
| InChI | InChI=1S/C18H17Cl2FN4O2/c1-2-26-3-4-27-17-8-15-10(5-14(17)22)18(24-9-23-15)25-16-7-12(20)11(19)6-13(16)21/h5-9H,2-4,22H2,1H3,(H,23,24,25) |
| InChIKey | FXQLEQVGDHSBLQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|