C25H27Cl2FN4O5 — CID 69319880
N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide (PubChem CID 69319880) has the molecular formula C25H27Cl2FN4O5 and a molecular weight of 553.42 g/mol. Its IUPAC name is N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69319880 |
| Molecular Formula | C25H27Cl2FN4O5 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3cc(Cl)c(Cl)cc3F)ncnc2cc1OCCOCCOCCOCC |
| InChI | InChI=1S/C25H27Cl2FN4O5/c1-3-24(33)31-22-11-16-20(14-23(22)37-10-9-36-8-7-35-6-5-34-4-2)29-15-30-25(16)32-21-13-18(27)17(26)12-19(21)28/h3,11-15H,1,4-10H2,2H3,(H,31,33)(H,29,30,32) |
| InChIKey | DRZRGERWCAQVAJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|