C29H37Cl2FN4O8 — CID 69314407
N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]-2-methoxyacetamide (PubChem CID 69314407) has the molecular formula C29H37Cl2FN4O8 and a molecular weight of 659.54 g/mol. Its IUPAC name is N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]-2-methoxyacetamide.
| Compound Name | N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 69314407 |
| Molecular Formula | C29H37Cl2FN4O8 |
| Molecular Weight | 659.54 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | N-[4-(4,5-dichloro-2-fluoroanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]-2-methoxyacetamide |
| SMILES | CCOCCOCCOCCOCCOCCOc1cc2ncnc(Nc3cc(Cl)c(Cl)cc3F)c2cc1NC(=O)COC |
| InChI | InChI=1S/C29H37Cl2FN4O8/c1-3-39-4-5-40-6-7-41-8-9-42-10-11-43-12-13-44-27-17-24-20(14-26(27)35-28(37)18-38-2)29(34-19-33-24)36-25-16-22(31)21(30)15-23(25)32/h14-17,19H,3-13,18H2,1-2H3,(H,35,37)(H,33,34,36) |
| InChIKey | SIILRGZHVIEAJT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|