C19H17Cl2FN4O7S — CID 86618842
2-[2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethyl methanesulfonate (PubChem CID 86618842) has the molecular formula C19H17Cl2FN4O7S and a molecular weight of 535.34 g/mol. Its IUPAC name is 2-[2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 86618842 |
| Molecular Formula | C19H17Cl2FN4O7S |
| Molecular Weight | 535.34 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | 2-[2-[4-(4,5-dichloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCOc1cc2ncnc(Nc3cc(Cl)c(Cl)cc3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17Cl2FN4O7S/c1-34(29,30)33-5-3-31-2-4-32-18-9-15-11(6-17(18)26(27)28)19(24-10-23-15)25-16-8-13(21)12(20)7-14(16)22/h6-10H,2-5H2,1H3,(H,23,24,25) |
| InChIKey | GIGWGBOPWYHLDA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|