C20H18F2N6O5 — CID 69100239
5-[[7-(2-acetamidoethoxy)-6-nitroquinazolin-4-yl]amino]-2,4-difluoro-N-methylbenzamide (PubChem CID 69100239) has the molecular formula C20H18F2N6O5 and a molecular weight of 460.40 g/mol. Its IUPAC name is 5-[[7-(2-acetamidoethoxy)-6-nitroquinazolin-4-yl]amino]-2,4-difluoro-N-methylbenzamide.
| Compound Name | 5-[[7-(2-acetamidoethoxy)-6-nitroquinazolin-4-yl]amino]-2,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 69100239 |
| Molecular Formula | C20H18F2N6O5 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 5-[[7-(2-acetamidoethoxy)-6-nitroquinazolin-4-yl]amino]-2,4-difluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(Nc2ncnc3cc(OCCNC(C)=O)c([N+](=O)[O-])cc23)c(F)cc1F |
| InChI | InChI=1S/C20H18F2N6O5/c1-10(29)24-3-4-33-18-8-15-12(6-17(18)28(31)32)19(26-9-25-15)27-16-5-11(20(30)23-2)13(21)7-14(16)22/h5-9H,3-4H2,1-2H3,(H,23,30)(H,24,29)(H,25,26,27) |
| InChIKey | LXJWHXWDBDJZKC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|