C17H13BrFN5O5 — CID 69100575
2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid (PubChem CID 69100575) has the molecular formula C17H13BrFN5O5 and a molecular weight of 466.22 g/mol. Its IUPAC name is 2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid.
| Compound Name | 2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid |
|---|---|
| PubChem CID | 69100575 |
| Molecular Formula | C17H13BrFN5O5 |
| Molecular Weight | 466.22 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylcarbamic acid |
| SMILES | O=C(O)NCCOc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13BrFN5O5/c18-9-1-2-12(11(19)5-9)23-16-10-6-14(24(27)28)15(7-13(10)21-8-22-16)29-4-3-20-17(25)26/h1-2,5-8,20H,3-4H2,(H,25,26)(H,21,22,23) |
| InChIKey | DMGASAGHXJORPJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|