C20H20ClFN4O6 — CID 10624089
2-[2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethoxy]ethanol (PubChem CID 10624089) has the molecular formula C20H20ClFN4O6 and a molecular weight of 466.85 g/mol. Its IUPAC name is 2-[2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 10624089 |
| Molecular Formula | C20H20ClFN4O6 |
| Molecular Weight | 466.85 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2-[2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethoxy]ethoxy]ethanol |
| SMILES | O=[N+]([O-])c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCOCCOCCO |
| InChI | InChI=1S/C20H20ClFN4O6/c21-15-9-13(1-2-16(15)22)25-20-14-10-18(26(28)29)19(11-17(14)23-12-24-20)32-8-7-31-6-5-30-4-3-27/h1-2,9-12,27H,3-8H2,(H,23,24,25) |
| InChIKey | DTSXCIBQIYHNOM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|