C29H37BrN4O7 — CID 69314895
N-[4-(3-bromoanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide (PubChem CID 69314895) has the molecular formula C29H37BrN4O7 and a molecular weight of 633.54 g/mol. Its IUPAC name is N-[4-(3-bromoanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(3-bromoanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69314895 |
| Molecular Formula | C29H37BrN4O7 |
| Molecular Weight | 633.54 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | N-[4-(3-bromoanilino)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3cccc(Br)c3)ncnc2cc1OCCOCCOCCOCCOCCOCC |
| InChI | InChI=1S/C29H37BrN4O7/c1-3-28(35)34-26-19-24-25(31-21-32-29(24)33-23-7-5-6-22(30)18-23)20-27(26)41-17-16-40-15-14-39-13-12-38-11-10-37-9-8-36-4-2/h3,5-7,18-21H,1,4,8-17H2,2H3,(H,34,35)(H,31,32,33) |
| InChIKey | SCWOGYASMSBIFA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|