C24H22F3N5O4 — CID 66556108
N-[4-[[7-(2-methoxyethoxy)-6-(prop-2-enoylamino)quinazolin-4-yl]amino]-2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 66556108) has the molecular formula C24H22F3N5O4 and a molecular weight of 501.47 g/mol. Its IUPAC name is N-[4-[[7-(2-methoxyethoxy)-6-(prop-2-enoylamino)quinazolin-4-yl]amino]-2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-[[7-(2-methoxyethoxy)-6-(prop-2-enoylamino)quinazolin-4-yl]amino]-2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66556108 |
| Molecular Formula | C24H22F3N5O4 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N-[4-[[7-(2-methoxyethoxy)-6-(prop-2-enoylamino)quinazolin-4-yl]amino]-2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(NC(=O)C=C)c(C(F)(F)F)c3)ncnc2cc1OCCOC |
| InChI | InChI=1S/C24H22F3N5O4/c1-4-21(33)31-17-7-6-14(10-16(17)24(25,26)27)30-23-15-11-19(32-22(34)5-2)20(36-9-8-35-3)12-18(15)28-13-29-23/h4-7,10-13H,1-2,8-9H2,3H3,(H,31,33)(H,32,34)(H,28,29,30) |
| InChIKey | PAWXHHDPFDLOAD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|