C26H24N6O3 — CID 58139939
6-(2-cyclopropyloxyethoxy)-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)phenyl]quinazolin-4-amine (PubChem CID 58139939) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 6-(2-cyclopropyloxyethoxy)-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)phenyl]quinazolin-4-amine.
| Compound Name | 6-(2-cyclopropyloxyethoxy)-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 58139939 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-(2-cyclopropyloxyethoxy)-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)phenyl]quinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3ccc(OCCOC4CC4)cc23)ccc1Oc1ccc2ncnn2c1 |
| InChI | InChI=1S/C26H24N6O3/c1-17-12-18(2-8-24(17)35-21-6-9-25-28-16-30-32(25)14-21)31-26-22-13-20(5-7-23(22)27-15-29-26)34-11-10-33-19-3-4-19/h2,5-9,12-16,19H,3-4,10-11H2,1H3,(H,27,29,31) |
| InChIKey | RZOIOBUKGUWQLH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|