C31H35N7O2 — CID 58139957
N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine (PubChem CID 58139957) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine.
| Compound Name | N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 58139957 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3ccc(OCCCN4CCN(C)CC4)cc23)ccc1Oc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C31H35N7O2/c1-22-17-23(5-10-30(22)40-25-7-9-29-28(19-25)34-21-37(29)3)35-31-26-18-24(6-8-27(26)32-20-33-31)39-16-4-11-38-14-12-36(2)13-15-38/h5-10,17-21H,4,11-16H2,1-3H3,(H,32,33,35) |
| InChIKey | DKOIYQNQNYNCIK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|