C30H33N5O2 — CID 70987538
6-(2-methylhexoxy)-N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]quinazolin-4-amine (PubChem CID 70987538) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 6-(2-methylhexoxy)-N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]quinazolin-4-amine.
| Compound Name | 6-(2-methylhexoxy)-N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 70987538 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 6-(2-methylhexoxy)-N-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]quinazolin-4-amine |
| SMILES | CCCCC(C)COc1ccc2ncnc(Nc3ccc(Oc4ccc5c(c4)ncn5C)c(C)c3)c2c1 |
| InChI | InChI=1S/C30H33N5O2/c1-5-6-7-20(2)17-36-23-9-11-26-25(15-23)30(32-18-31-26)34-22-8-13-29(21(3)14-22)37-24-10-12-28-27(16-24)33-19-35(28)4/h8-16,18-20H,5-7,17H2,1-4H3,(H,31,32,34) |
| InChIKey | FVIUIIGLCNPZGT-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |