C22H15F3N4O6S — CID 146470038
[4-(3-methyl-4-phenoxyanilino)-6-nitroquinazolin-7-yl] trifluoromethanesulfonate (PubChem CID 146470038) has the molecular formula C22H15F3N4O6S and a molecular weight of 520.45 g/mol. Its IUPAC name is [4-(3-methyl-4-phenoxyanilino)-6-nitroquinazolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [4-(3-methyl-4-phenoxyanilino)-6-nitroquinazolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146470038 |
| Molecular Formula | C22H15F3N4O6S |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | [4-(3-methyl-4-phenoxyanilino)-6-nitroquinazolin-7-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(Nc2ncnc3cc(OS(=O)(=O)C(F)(F)F)c([N+](=O)[O-])cc23)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C22H15F3N4O6S/c1-13-9-14(7-8-19(13)34-15-5-3-2-4-6-15)28-21-16-10-18(29(30)31)20(11-17(16)26-12-27-21)35-36(32,33)22(23,24)25/h2-12H,1H3,(H,26,27,28) |
| InChIKey | GPNNJPLSZZVXPA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|