C24H23N5O3 — CID 162431536
ethane;N-[4-[(6-ethenyl-3-pyridinyl)oxy]-3-methylphenyl]-6-nitroquinazolin-4-amine (PubChem CID 162431536) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is ethane;N-[4-[(6-ethenyl-3-pyridinyl)oxy]-3-methylphenyl]-6-nitroquinazolin-4-amine.
| Compound Name | ethane;N-[4-[(6-ethenyl-3-pyridinyl)oxy]-3-methylphenyl]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 162431536 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | ethane;N-[4-[(6-ethenyl-3-pyridinyl)oxy]-3-methylphenyl]-6-nitroquinazolin-4-amine |
| SMILES | C=Cc1ccc(Oc2ccc(Nc3ncnc4ccc([N+](=O)[O-])cc34)cc2C)cn1.CC |
| InChI | InChI=1S/C22H17N5O3.C2H6/c1-3-15-4-7-18(12-23-15)30-21-9-5-16(10-14(21)2)26-22-19-11-17(27(28)29)6-8-20(19)24-13-25-22;1-2/h3-13H,1H2,2H3,(H,24,25,26);1-2H3 |
| InChIKey | JCSGECFRVXEPPD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|